2-(2,5-dimethylanilino)-5-(2-fluorobenzamido)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-(2,5-dimethylanilino)-5-(2-fluorobenzamido)-1,3-thiazole-4-carboxamide
2-(2,5-dimethylanilino)-5-(2-fluorobenzamido)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | D686-0186 |
| Compound Name: | 2-(2,5-dimethylanilino)-5-(2-fluorobenzamido)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C19 H17 F N4 O2 S |
| Smiles: | Cc1ccc(C)c(c1)Nc1nc(C(N)=O)c(NC(c2ccccc2F)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.3705 |
| logD: | 3.1274 |
| logSw: | -3.8178 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 75.196 |
| InChI Key: | GNHLSBFFMBSNIG-UHFFFAOYSA-N |