2-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]-N-[(furan-2-yl)methyl]acetamide
Chemical Structure Depiction of
2-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]-N-[(furan-2-yl)methyl]acetamide
2-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]-N-[(furan-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | D699-0095 |
| Compound Name: | 2-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]-N-[(furan-2-yl)methyl]acetamide |
| Molecular Weight: | 401.43 |
| Molecular Formula: | C21 H19 N7 O2 |
| Smiles: | Cc1cc(C)n(c2nc3c(c4ccccc4n3CC(NCc3ccco3)=O)nn2)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.5848 |
| logD: | 2.5847 |
| logSw: | -2.9085 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.275 |
| InChI Key: | NEABWROIQILRSJ-UHFFFAOYSA-N |