[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]acetonitrile
Chemical Structure Depiction of
[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]acetonitrile
[3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]acetonitrile
Compound characteristics
| Compound ID: | D699-0142 |
| Compound Name: | [3-(3,5-dimethyl-1H-pyrazol-1-yl)-5H-[1,2,4]triazino[5,6-b]indol-5-yl]acetonitrile |
| Molecular Weight: | 303.32 |
| Molecular Formula: | C16 H13 N7 |
| Smiles: | Cc1cc(C)n(c2nc3c(c4ccccc4n3CC#N)nn2)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.7015 |
| logD: | 1.7015 |
| logSw: | -1.524 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 64.797 |
| InChI Key: | LFBUJVRQDWBUEQ-UHFFFAOYSA-N |