N-(4-ethylphenyl)-2-{3-[(4-methylphenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-2-{3-[(4-methylphenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide
N-(4-ethylphenyl)-2-{3-[(4-methylphenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | D702-0219 |
| Compound Name: | N-(4-ethylphenyl)-2-{3-[(4-methylphenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide |
| Molecular Weight: | 377.44 |
| Molecular Formula: | C22 H23 N3 O3 |
| Smiles: | CCc1ccc(cc1)NC(CN1C(C=CN(Cc2ccc(C)cc2)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3134 |
| logD: | 3.3134 |
| logSw: | -3.3489 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.306 |
| InChI Key: | QRCAATFVGAHYTP-UHFFFAOYSA-N |