N-(5-chloro-2-methoxyphenyl)-2-{3-[(4-fluorophenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-2-{3-[(4-fluorophenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide
N-(5-chloro-2-methoxyphenyl)-2-{3-[(4-fluorophenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | D702-0523 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-2-{3-[(4-fluorophenyl)methyl]-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl}acetamide |
| Molecular Weight: | 417.82 |
| Molecular Formula: | C20 H17 Cl F N3 O4 |
| Smiles: | COc1ccc(cc1NC(CN1C(C=CN(Cc2ccc(cc2)F)C1=O)=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.2413 |
| logD: | 2.2395 |
| logSw: | -3.3336 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.238 |
| InChI Key: | WQABLOFFAJGNBW-UHFFFAOYSA-N |