N-[(4-fluorophenyl)methyl]-6-methyl-3-[5-(propan-2-yl)-1,2,4-oxadiazol-3-yl]quinolin-2-amine
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-6-methyl-3-[5-(propan-2-yl)-1,2,4-oxadiazol-3-yl]quinolin-2-amine
N-[(4-fluorophenyl)methyl]-6-methyl-3-[5-(propan-2-yl)-1,2,4-oxadiazol-3-yl]quinolin-2-amine
Compound characteristics
| Compound ID: | D704-0800 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-6-methyl-3-[5-(propan-2-yl)-1,2,4-oxadiazol-3-yl]quinolin-2-amine |
| Molecular Weight: | 376.43 |
| Molecular Formula: | C22 H21 F N4 O |
| Smiles: | CC(C)c1nc(c2cc3cc(C)ccc3nc2NCc2ccc(cc2)F)no1 |
| Stereo: | ACHIRAL |
| logP: | 6.093 |
| logD: | 5.1822 |
| logSw: | -5.8691 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.121 |
| InChI Key: | ORXUBOVRSVBAEK-UHFFFAOYSA-N |