N-(3,5-dimethylphenyl)-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]benzamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]benzamide
N-(3,5-dimethylphenyl)-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]benzamide
Compound characteristics
| Compound ID: | D705-0321 |
| Compound Name: | N-(3,5-dimethylphenyl)-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]benzamide |
| Molecular Weight: | 399.45 |
| Molecular Formula: | C24 H21 N3 O3 |
| Smiles: | Cc1cc(C)cc(c1)NC(c1ccccc1OCc1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4864 |
| logD: | 5.4861 |
| logSw: | -5.4966 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.987 |
| InChI Key: | CQZIRCDIEAAYMS-UHFFFAOYSA-N |