N-(2,3-dihydro-1H-indole-1-carbonyl)-beta-alanine
Chemical Structure Depiction of
N-(2,3-dihydro-1H-indole-1-carbonyl)-beta-alanine
N-(2,3-dihydro-1H-indole-1-carbonyl)-beta-alanine
Compound characteristics
| Compound ID: | D715-0188 |
| Compound Name: | N-(2,3-dihydro-1H-indole-1-carbonyl)-beta-alanine |
| Molecular Weight: | 234.25 |
| Molecular Formula: | C12 H14 N2 O3 |
| Smiles: | C(CNC(N1CCc2ccccc12)=O)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.9824 |
| logD: | -1.7133 |
| logSw: | -1.7619 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.557 |
| InChI Key: | IHSHKNLQFZAXRE-UHFFFAOYSA-N |