[(4-oxo-1,2,3,4-tetrahydrobenzo[b]cyclopenta[d]pyran-7-yl)oxy](phenyl)acetic acid
Chemical Structure Depiction of
[(4-oxo-1,2,3,4-tetrahydrobenzo[b]cyclopenta[d]pyran-7-yl)oxy](phenyl)acetic acid
[(4-oxo-1,2,3,4-tetrahydrobenzo[b]cyclopenta[d]pyran-7-yl)oxy](phenyl)acetic acid
Compound characteristics
| Compound ID: | D715-0219 |
| Compound Name: | [(4-oxo-1,2,3,4-tetrahydrobenzo[b]cyclopenta[d]pyran-7-yl)oxy](phenyl)acetic acid |
| Molecular Weight: | 336.34 |
| Molecular Formula: | C20 H16 O5 |
| Smiles: | C1CC2=C(C1)c1ccc(cc1OC2=O)OC(C(O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7965 |
| logD: | -1.4285 |
| logSw: | -3.3325 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.359 |
| InChI Key: | VTULPAQMHCOZTG-GOSISDBHSA-N |