N-{[(4-ethyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetyl}glycine
Chemical Structure Depiction of
N-{[(4-ethyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetyl}glycine
N-{[(4-ethyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetyl}glycine
Compound characteristics
| Compound ID: | D715-0355 |
| Compound Name: | N-{[(4-ethyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetyl}glycine |
| Molecular Weight: | 319.31 |
| Molecular Formula: | C16 H17 N O6 |
| Smiles: | CCC1=CC(=O)Oc2c1ccc(c2C)OCC(NCC(O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8371 |
| logD: | -3.0491 |
| logSw: | -2.4183 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.771 |
| InChI Key: | NKMWABKCXZZXSA-UHFFFAOYSA-N |