N-{2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}glycine
Chemical Structure Depiction of
N-{2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}glycine
N-{2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}glycine
Compound characteristics
| Compound ID: | D715-0520 |
| Compound Name: | N-{2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoyl}glycine |
| Molecular Weight: | 409.44 |
| Molecular Formula: | C23 H23 N O6 |
| Smiles: | CC(C(NCC(O)=O)=O)Oc1ccc2C(C)=C(Cc3ccccc3)C(=O)Oc2c1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6659 |
| logD: | -1.2203 |
| logSw: | -3.1396 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.517 |
| InChI Key: | VHLGYLBUHKUHLS-HNNXBMFYSA-N |