4,5-dimethoxy-N-[3-(3-methoxyanilino)-3-oxopropyl]-1H-indole-2-carboxamide
Chemical Structure Depiction of
4,5-dimethoxy-N-[3-(3-methoxyanilino)-3-oxopropyl]-1H-indole-2-carboxamide
4,5-dimethoxy-N-[3-(3-methoxyanilino)-3-oxopropyl]-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | D715-0862 |
| Compound Name: | 4,5-dimethoxy-N-[3-(3-methoxyanilino)-3-oxopropyl]-1H-indole-2-carboxamide |
| Molecular Weight: | 397.43 |
| Molecular Formula: | C21 H23 N3 O5 |
| Smiles: | COc1cccc(c1)NC(CCNC(c1cc2c(c(ccc2[nH]1)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4437 |
| logD: | 2.4436 |
| logSw: | -3.0889 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 79.883 |
| InChI Key: | DWLJVOVGYJSZOH-UHFFFAOYSA-N |