7-[(4-chlorophenyl)methoxy]-6-ethyl-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one
Chemical Structure Depiction of
7-[(4-chlorophenyl)methoxy]-6-ethyl-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one
7-[(4-chlorophenyl)methoxy]-6-ethyl-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one
Compound characteristics
| Compound ID: | D715-0901 |
| Compound Name: | 7-[(4-chlorophenyl)methoxy]-6-ethyl-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one |
| Molecular Weight: | 411.91 |
| Molecular Formula: | C22 H18 Cl N O3 S |
| Smiles: | CCc1cc2C(C(=COc2cc1OCc1ccc(cc1)[Cl])c1nc(C)cs1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7329 |
| logD: | 5.7329 |
| logSw: | -5.8643 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.986 |
| InChI Key: | LQNBZOMGLNLPCU-UHFFFAOYSA-N |