6-ethyl-7-[(4-methylphenyl)methoxy]-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one
Chemical Structure Depiction of
6-ethyl-7-[(4-methylphenyl)methoxy]-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one
6-ethyl-7-[(4-methylphenyl)methoxy]-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one
Compound characteristics
| Compound ID: | D715-0907 |
| Compound Name: | 6-ethyl-7-[(4-methylphenyl)methoxy]-3-(4-methyl-1,3-thiazol-2-yl)-4H-1-benzopyran-4-one |
| Molecular Weight: | 391.49 |
| Molecular Formula: | C23 H21 N O3 S |
| Smiles: | CCc1cc2C(C(=COc2cc1OCc1ccc(C)cc1)c1nc(C)cs1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5616 |
| logD: | 5.5616 |
| logSw: | -5.3955 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.986 |
| InChI Key: | KAXTZISZUVKJSJ-UHFFFAOYSA-N |