{[3-(carboxymethyl)-4-methyl-2-oxo-2H-1-benzopyran-7-yl]oxy}(phenyl)acetic acid
Chemical Structure Depiction of
{[3-(carboxymethyl)-4-methyl-2-oxo-2H-1-benzopyran-7-yl]oxy}(phenyl)acetic acid
{[3-(carboxymethyl)-4-methyl-2-oxo-2H-1-benzopyran-7-yl]oxy}(phenyl)acetic acid
Compound characteristics
| Compound ID: | D715-1205 |
| Compound Name: | {[3-(carboxymethyl)-4-methyl-2-oxo-2H-1-benzopyran-7-yl]oxy}(phenyl)acetic acid |
| Molecular Weight: | 368.34 |
| Molecular Formula: | C20 H16 O7 |
| Smiles: | CC1=C(CC(O)=O)C(=O)Oc2cc(ccc12)OC(C(O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.017 |
| logD: | -2.2081 |
| logSw: | -2.8752 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 84.456 |
| InChI Key: | NQHVNLINTKEZCO-GOSISDBHSA-N |