5-amino-4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-phenyl-1,2-dihydro-3H-pyrrol-3-one
Chemical Structure Depiction of
5-amino-4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-phenyl-1,2-dihydro-3H-pyrrol-3-one
5-amino-4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-phenyl-1,2-dihydro-3H-pyrrol-3-one
Compound characteristics
| Compound ID: | D715-1801 |
| Compound Name: | 5-amino-4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-phenyl-1,2-dihydro-3H-pyrrol-3-one |
| Molecular Weight: | 285.37 |
| Molecular Formula: | C15 H15 N3 O S |
| Smiles: | Cc1c(C)sc(C2=C(N)N(CC2=O)c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.5498 |
| logD: | 2.5498 |
| logSw: | -2.67 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.282 |
| InChI Key: | RXNLLSXSLZTGKV-UHFFFAOYSA-N |