N-{1-[(furan-2-yl)methyl]-4,5-dimethyl-3-(4-methylbenzene-1-sulfonyl)-1H-pyrrol-2-yl}pentanamide
Chemical Structure Depiction of
N-{1-[(furan-2-yl)methyl]-4,5-dimethyl-3-(4-methylbenzene-1-sulfonyl)-1H-pyrrol-2-yl}pentanamide
N-{1-[(furan-2-yl)methyl]-4,5-dimethyl-3-(4-methylbenzene-1-sulfonyl)-1H-pyrrol-2-yl}pentanamide
Compound characteristics
| Compound ID: | D715-2062 |
| Compound Name: | N-{1-[(furan-2-yl)methyl]-4,5-dimethyl-3-(4-methylbenzene-1-sulfonyl)-1H-pyrrol-2-yl}pentanamide |
| Molecular Weight: | 428.55 |
| Molecular Formula: | C23 H28 N2 O4 S |
| Smiles: | CCCCC(Nc1c(c(C)c(C)n1Cc1ccco1)S(c1ccc(C)cc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5542 |
| logD: | 4.5501 |
| logSw: | -4.226 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.007 |
| InChI Key: | FKBMKIVEVBUZPO-UHFFFAOYSA-N |