N-[3-(benzenesulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-yl]-2-methoxybenzamide
Chemical Structure Depiction of
N-[3-(benzenesulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-yl]-2-methoxybenzamide
N-[3-(benzenesulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-yl]-2-methoxybenzamide
Compound characteristics
| Compound ID: | D715-2205 |
| Compound Name: | N-[3-(benzenesulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-yl]-2-methoxybenzamide |
| Molecular Weight: | 442.53 |
| Molecular Formula: | C23 H26 N2 O5 S |
| Smiles: | Cc1c(c(NC(c2ccccc2OC)=O)n(CCOC)c1C)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0819 |
| logD: | 2.34 |
| logSw: | -3.7189 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.423 |
| InChI Key: | TTYZRHLEKVSSDP-UHFFFAOYSA-N |