N-[3-(benzenesulfonyl)-1-benzyl-4,5-dimethyl-1H-pyrrol-2-yl]-2-methylpropanamide
					Chemical Structure Depiction of
N-[3-(benzenesulfonyl)-1-benzyl-4,5-dimethyl-1H-pyrrol-2-yl]-2-methylpropanamide
			N-[3-(benzenesulfonyl)-1-benzyl-4,5-dimethyl-1H-pyrrol-2-yl]-2-methylpropanamide
Compound characteristics
| Compound ID: | D715-2288 | 
| Compound Name: | N-[3-(benzenesulfonyl)-1-benzyl-4,5-dimethyl-1H-pyrrol-2-yl]-2-methylpropanamide | 
| Molecular Weight: | 410.53 | 
| Molecular Formula: | C23 H26 N2 O3 S | 
| Smiles: | CC(C)C(Nc1c(c(C)c(C)n1Cc1ccccc1)S(c1ccccc1)(=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.3405 | 
| logD: | 4.3372 | 
| logSw: | -4.1844 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 54.471 | 
| InChI Key: | VQBVIJZGJUVENH-UHFFFAOYSA-N | 
 
				 
				