3,4-dihydroxy-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
3,4-dihydroxy-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
3,4-dihydroxy-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | D715-2438 |
| Compound Name: | 3,4-dihydroxy-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 232.23 |
| Molecular Formula: | C13 H12 O4 |
| Smiles: | C1CCC2=C(C1)C(=O)Oc1c2ccc(c1O)O |
| Stereo: | ACHIRAL |
| logP: | 2.6998 |
| logD: | 2.6381 |
| logSw: | -2.9237 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.792 |
| InChI Key: | MXBLPWAUEWFCJU-UHFFFAOYSA-N |