{2-[4-(propan-2-yl)phenyl]-1,3-thiazol-4-yl}acetic acid
Chemical Structure Depiction of
{2-[4-(propan-2-yl)phenyl]-1,3-thiazol-4-yl}acetic acid
{2-[4-(propan-2-yl)phenyl]-1,3-thiazol-4-yl}acetic acid
Compound characteristics
| Compound ID: | D715-2482 |
| Compound Name: | {2-[4-(propan-2-yl)phenyl]-1,3-thiazol-4-yl}acetic acid |
| Molecular Weight: | 261.34 |
| Molecular Formula: | C14 H15 N O2 S |
| Smiles: | CC(C)c1ccc(cc1)c1nc(CC(O)=O)cs1 |
| Stereo: | ACHIRAL |
| logP: | 3.8964 |
| logD: | 0.7304 |
| logSw: | -4.0092 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.851 |
| InChI Key: | LEJRZYYIWWJVAT-UHFFFAOYSA-N |