(2-phenyl-1,3-thiazol-4-yl)acetic acid
Chemical Structure Depiction of
(2-phenyl-1,3-thiazol-4-yl)acetic acid
(2-phenyl-1,3-thiazol-4-yl)acetic acid
Compound characteristics
| Compound ID: | D715-2487 |
| Compound Name: | (2-phenyl-1,3-thiazol-4-yl)acetic acid |
| Molecular Weight: | 219.26 |
| Molecular Formula: | C11 H9 N O2 S |
| Smiles: | C(C(O)=O)c1csc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.4531 |
| logD: | -0.7129 |
| logSw: | -2.506 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.851 |
| InChI Key: | LYHDWKGJPJRCTG-UHFFFAOYSA-N |