2-[(2-chlorophenyl)methyl]-1-hydroxy-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
Chemical Structure Depiction of
2-[(2-chlorophenyl)methyl]-1-hydroxy-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
2-[(2-chlorophenyl)methyl]-1-hydroxy-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
Compound characteristics
| Compound ID: | D724-0182 |
| Compound Name: | 2-[(2-chlorophenyl)methyl]-1-hydroxy-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| Molecular Weight: | 347.8 |
| Molecular Formula: | C20 H14 Cl N3 O |
| Smiles: | Cc1c(Cc2ccccc2[Cl])c(n2c3ccccc3nc2c1C#N)O |
| Stereo: | ACHIRAL |
| logP: | 4.922 |
| logD: | 2.8172 |
| logSw: | -4.5423 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.268 |
| InChI Key: | MZUBGHOJXOVYNV-UHFFFAOYSA-N |