5-tert-butyl-3-(4-chlorophenyl)-2-methyl-7-(4-methylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine
Chemical Structure Depiction of
5-tert-butyl-3-(4-chlorophenyl)-2-methyl-7-(4-methylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine
5-tert-butyl-3-(4-chlorophenyl)-2-methyl-7-(4-methylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine
Compound characteristics
| Compound ID: | D724-0322 |
| Compound Name: | 5-tert-butyl-3-(4-chlorophenyl)-2-methyl-7-(4-methylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine |
| Molecular Weight: | 397.95 |
| Molecular Formula: | C22 H28 Cl N5 |
| Smiles: | Cc1c(c2ccc(cc2)[Cl])c2nc(cc(N3CCN(C)CC3)n2n1)C(C)(C)C |
| Stereo: | ACHIRAL |
| logP: | 5.0839 |
| logD: | 3.2789 |
| logSw: | -5.7892 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.5271 |
| InChI Key: | NZQMGXGSRVUJLQ-UHFFFAOYSA-N |