3-(4-chlorophenyl)-N-cyclopentyl-5-methylpyrazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
3-(4-chlorophenyl)-N-cyclopentyl-5-methylpyrazolo[1,5-a]pyrimidin-7-amine
3-(4-chlorophenyl)-N-cyclopentyl-5-methylpyrazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D724-0484 |
| Compound Name: | 3-(4-chlorophenyl)-N-cyclopentyl-5-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 326.83 |
| Molecular Formula: | C18 H19 Cl N4 |
| Smiles: | Cc1cc(NC2CCCC2)n2c(c(cn2)c2ccc(cc2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 4.8755 |
| logD: | 4.1533 |
| logSw: | -5.0455 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.6404 |
| InChI Key: | IXMWDIRAWQZSJQ-UHFFFAOYSA-N |