5,6-dimethyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
5,6-dimethyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine
5,6-dimethyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D724-0817 |
| Compound Name: | 5,6-dimethyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 308.42 |
| Molecular Formula: | C19 H24 N4 |
| Smiles: | CCCCCNc1c(C)c(C)nc2c(cnn12)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0947 |
| logD: | 4.098 |
| logSw: | -4.885 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.5107 |
| InChI Key: | DTOAASYRUSLAQL-UHFFFAOYSA-N |