4-ethyl-N-[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide
Chemical Structure Depiction of
4-ethyl-N-[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide
4-ethyl-N-[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | D725-0020 |
| Compound Name: | 4-ethyl-N-[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| Molecular Weight: | 357.41 |
| Molecular Formula: | C22 H19 N3 O2 |
| Smiles: | CCc1ccc(cc1)C(Nc1cc(ccc1C)c1nc2c(cccn2)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7304 |
| logD: | 4.7304 |
| logSw: | -4.3662 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.816 |
| InChI Key: | FBCIAOQNMBLQAJ-UHFFFAOYSA-N |