3-(4-methoxyphenyl)-6-[(4-methylphenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-(4-methoxyphenyl)-6-[(4-methylphenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-(4-methoxyphenyl)-6-[(4-methylphenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | D727-0006 |
| Compound Name: | 3-(4-methoxyphenyl)-6-[(4-methylphenoxy)methyl][1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 352.41 |
| Molecular Formula: | C18 H16 N4 O2 S |
| Smiles: | Cc1ccc(cc1)OCc1nn2c(c3ccc(cc3)OC)nnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 3.8499 |
| logD: | 3.8499 |
| logSw: | -3.9819 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.26 |
| InChI Key: | PBIFTXWRTCIGBS-UHFFFAOYSA-N |