6-[(3-methylphenoxy)methyl]-3-(3-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
6-[(3-methylphenoxy)methyl]-3-(3-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
6-[(3-methylphenoxy)methyl]-3-(3-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | D727-0359 |
| Compound Name: | 6-[(3-methylphenoxy)methyl]-3-(3-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 336.41 |
| Molecular Formula: | C18 H16 N4 O S |
| Smiles: | Cc1cccc(c1)c1nnc2n1nc(COc1cccc(C)c1)s2 |
| Stereo: | ACHIRAL |
| logP: | 4.3047 |
| logD: | 4.3047 |
| logSw: | -4.4663 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.716 |
| InChI Key: | HPSMARIHKVVKOR-UHFFFAOYSA-N |