N-(3-acetylphenyl)-5-cyclopropyl-1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(3-acetylphenyl)-5-cyclopropyl-1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide
N-(3-acetylphenyl)-5-cyclopropyl-1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | D731-0548 |
| Compound Name: | N-(3-acetylphenyl)-5-cyclopropyl-1-(4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C21 H20 N4 O2 |
| Smiles: | CC(c1cccc(c1)NC(c1c(C2CC2)n(c2ccc(C)cc2)nn1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1699 |
| logD: | 4.1667 |
| logSw: | -4.2461 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.28 |
| InChI Key: | NTYUQJKPYBEYHN-UHFFFAOYSA-N |