7-chloro-N-(4-methoxyphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-3-carboxamide
Chemical Structure Depiction of
7-chloro-N-(4-methoxyphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-3-carboxamide
7-chloro-N-(4-methoxyphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | D731-0565 |
| Compound Name: | 7-chloro-N-(4-methoxyphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-3-carboxamide |
| Molecular Weight: | 331.75 |
| Molecular Formula: | C17 H14 Cl N O4 |
| Smiles: | COc1ccc(cc1)NC(C1Cc2ccc(cc2C(=O)O1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.521 |
| logD: | 3.5209 |
| logSw: | -3.8383 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.698 |
| InChI Key: | NGCDTGVRSYOGDZ-OAHLLOKOSA-N |