N-(3-chloro-4-methoxyphenyl)-3-(4-fluorophenyl)-5-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-7-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-3-(4-fluorophenyl)-5-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-7-carboxamide
N-(3-chloro-4-methoxyphenyl)-3-(4-fluorophenyl)-5-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-7-carboxamide
Compound characteristics
| Compound ID: | D733-0534 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-3-(4-fluorophenyl)-5-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-7-carboxamide |
| Molecular Weight: | 414.82 |
| Molecular Formula: | C20 H16 Cl F N4 O3 |
| Smiles: | COc1ccc(cc1[Cl])NC(C1CC(Nc2c(cnn12)c1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.225 |
| logD: | 3.2243 |
| logSw: | -3.6605 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.147 |
| InChI Key: | FXXAOHPKTNZFDC-INIZCTEOSA-N |