1-[9'-chloro-2'-(4-methoxyphenyl)-1',10'b-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazin]-1-yl]ethan-1-one
Chemical Structure Depiction of
1-[9'-chloro-2'-(4-methoxyphenyl)-1',10'b-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazin]-1-yl]ethan-1-one
1-[9'-chloro-2'-(4-methoxyphenyl)-1',10'b-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazin]-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | D733-0570 |
| Compound Name: | 1-[9'-chloro-2'-(4-methoxyphenyl)-1',10'b-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazin]-1-yl]ethan-1-one |
| Molecular Weight: | 425.91 |
| Molecular Formula: | C23 H24 Cl N3 O3 |
| Smiles: | CC(N1CCC2(CC1)N1C(CC(c3ccc(cc3)OC)=N1)c1cc(ccc1O2)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2614 |
| logD: | 4.2612 |
| logSw: | -4.7238 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.591 |
| InChI Key: | CVXGMYONDJJTJO-NRFANRHFSA-N |