N-(2-cyanophenyl)-N'-(thiophen-2-yl)urea
Chemical Structure Depiction of
N-(2-cyanophenyl)-N'-(thiophen-2-yl)urea
N-(2-cyanophenyl)-N'-(thiophen-2-yl)urea
Compound characteristics
| Compound ID: | E002-0014 |
| Compound Name: | N-(2-cyanophenyl)-N'-(thiophen-2-yl)urea |
| Molecular Weight: | 243.28 |
| Molecular Formula: | C12 H9 N3 O S |
| Smiles: | C(c1ccccc1NC(Nc1cccs1)=O)#N |
| Stereo: | ACHIRAL |
| logP: | 2.5593 |
| logD: | 2.5592 |
| logSw: | -3.2928 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.392 |
| InChI Key: | MYUGZUAHSOWGTR-UHFFFAOYSA-N |