2-(3-methyl-1H-indazol-1-yl)-N-[(4-propoxyphenyl)methyl]propanamide
Chemical Structure Depiction of
2-(3-methyl-1H-indazol-1-yl)-N-[(4-propoxyphenyl)methyl]propanamide
2-(3-methyl-1H-indazol-1-yl)-N-[(4-propoxyphenyl)methyl]propanamide
Compound characteristics
| Compound ID: | E002-0128 |
| Compound Name: | 2-(3-methyl-1H-indazol-1-yl)-N-[(4-propoxyphenyl)methyl]propanamide |
| Molecular Weight: | 351.45 |
| Molecular Formula: | C21 H25 N3 O2 |
| Smiles: | CCCOc1ccc(CNC(C(C)n2c3ccccc3c(C)n2)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3731 |
| logD: | 3.3731 |
| logSw: | -3.3556 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.215 |
| InChI Key: | ZYHLBSZDYSPRTM-INIZCTEOSA-N |