N-cycloheptyl-2-(3-methyl-1H-indazol-1-yl)propanamide
Chemical Structure Depiction of
N-cycloheptyl-2-(3-methyl-1H-indazol-1-yl)propanamide
N-cycloheptyl-2-(3-methyl-1H-indazol-1-yl)propanamide
Compound characteristics
| Compound ID: | E002-0139 |
| Compound Name: | N-cycloheptyl-2-(3-methyl-1H-indazol-1-yl)propanamide |
| Molecular Weight: | 299.41 |
| Molecular Formula: | C18 H25 N3 O |
| Smiles: | CC(C(NC1CCCCCC1)=O)n1c2ccccc2c(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5365 |
| logD: | 3.5365 |
| logSw: | -3.6957 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.853 |
| InChI Key: | GWDLJRRCTOOQIR-AWEZNQCLSA-N |