N-(2,5-dimethylphenyl)-6-methyl-1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-6-methyl-1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide
N-(2,5-dimethylphenyl)-6-methyl-1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide
Compound characteristics
| Compound ID: | E002-0249 |
| Compound Name: | N-(2,5-dimethylphenyl)-6-methyl-1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazine-2(1H)-carboxamide |
| Molecular Weight: | 325.45 |
| Molecular Formula: | C20 H27 N3 O |
| Smiles: | CCCC1c2ccc(C)n2CCN1C(Nc1cc(C)ccc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4332 |
| logD: | 4.4332 |
| logSw: | -4.0355 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.661 |
| InChI Key: | UFXMRKXMKLSNOI-SFHVURJKSA-N |