N-{5-[butyl(methyl)amino]-1,3,4-thiadiazol-2-yl}-N'-(2,5-dimethylphenyl)urea
Chemical Structure Depiction of
N-{5-[butyl(methyl)amino]-1,3,4-thiadiazol-2-yl}-N'-(2,5-dimethylphenyl)urea
N-{5-[butyl(methyl)amino]-1,3,4-thiadiazol-2-yl}-N'-(2,5-dimethylphenyl)urea
Compound characteristics
| Compound ID: | E002-0628 |
| Compound Name: | N-{5-[butyl(methyl)amino]-1,3,4-thiadiazol-2-yl}-N'-(2,5-dimethylphenyl)urea |
| Molecular Weight: | 333.45 |
| Molecular Formula: | C16 H23 N5 O S |
| Smiles: | CCCCN(C)c1nnc(NC(Nc2cc(C)ccc2C)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.9007 |
| logD: | 3.9007 |
| logSw: | -3.6509 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.408 |
| InChI Key: | FXNSSKZEAFRWCZ-UHFFFAOYSA-N |