2-(3,4-dimethoxyphenyl)-N-{2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide
Chemical Structure Depiction of
2-(3,4-dimethoxyphenyl)-N-{2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide
2-(3,4-dimethoxyphenyl)-N-{2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide
Compound characteristics
| Compound ID: | E002-2461 |
| Compound Name: | 2-(3,4-dimethoxyphenyl)-N-{2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl}acetamide |
| Molecular Weight: | 529.59 |
| Molecular Formula: | C30 H31 N3 O6 |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(c1c(c2ccccc2o1)NC(Cc1ccc(c(c1)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8767 |
| logD: | 3.7911 |
| logSw: | -4.1309 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.96 |
| InChI Key: | KWCCNZWFZJGUQQ-UHFFFAOYSA-N |