N-tert-butyl-3-[3-(4-methoxyphenyl)propanamido]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-tert-butyl-3-[3-(4-methoxyphenyl)propanamido]-1-benzofuran-2-carboxamide
N-tert-butyl-3-[3-(4-methoxyphenyl)propanamido]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | E002-2627 |
| Compound Name: | N-tert-butyl-3-[3-(4-methoxyphenyl)propanamido]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 394.47 |
| Molecular Formula: | C23 H26 N2 O4 |
| Smiles: | CC(C)(C)NC(c1c(c2ccccc2o1)NC(CCc1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1676 |
| logD: | 4.142 |
| logSw: | -4.2758 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.299 |
| InChI Key: | HFUYMGYEYGQOAB-UHFFFAOYSA-N |