N-(10-ethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepin-8-yl)-N'-(2-fluorophenyl)urea
Chemical Structure Depiction of
N-(10-ethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepin-8-yl)-N'-(2-fluorophenyl)urea
N-(10-ethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepin-8-yl)-N'-(2-fluorophenyl)urea
Compound characteristics
| Compound ID: | E006-0382 |
| Compound Name: | N-(10-ethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepin-8-yl)-N'-(2-fluorophenyl)urea |
| Molecular Weight: | 407.47 |
| Molecular Formula: | C22 H18 F N3 O2 S |
| Smiles: | CCN1C(c2ccccc2Sc2ccc(cc12)NC(Nc1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3675 |
| logD: | 5.3675 |
| logSw: | -5.3038 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.002 |
| InChI Key: | VVHRLRNUXJKQPZ-UHFFFAOYSA-N |