N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-8-methyl-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxamide
Chemical Structure Depiction of
N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-8-methyl-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxamide
N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-8-methyl-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxamide
Compound characteristics
| Compound ID: | E010-0262 |
| Compound Name: | N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-8-methyl-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxamide |
| Molecular Weight: | 425.57 |
| Molecular Formula: | C24 H35 N5 O2 |
| Smiles: | Cc1c2c3c(CCc2oc1C(NCCCN1CCN(CC1)C1CCCCC1)=O)cn[nH]3 |
| Stereo: | ACHIRAL |
| logP: | 2.8543 |
| logD: | 1.9439 |
| logSw: | -3.0306 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.576 |
| InChI Key: | ILSIQKLOVJOIKH-UHFFFAOYSA-N |