3-[benzyl(methyl)amino]-5-(3,4-dimethylphenyl)-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione
Chemical Structure Depiction of
3-[benzyl(methyl)amino]-5-(3,4-dimethylphenyl)-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione
3-[benzyl(methyl)amino]-5-(3,4-dimethylphenyl)-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione
Compound characteristics
| Compound ID: | E013-0305 |
| Compound Name: | 3-[benzyl(methyl)amino]-5-(3,4-dimethylphenyl)-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione |
| Molecular Weight: | 354.47 |
| Molecular Formula: | C20 H22 N2 O2 S |
| Smiles: | CC1=C(c2ccc(C)c(C)c2)S(N=C1N(C)Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5725 |
| logD: | 4.5725 |
| logSw: | -4.4518 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.632 |
| InChI Key: | BFKMLTIMSQXACO-UHFFFAOYSA-N |