3-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-5-[4-(propan-2-yl)phenyl]-1H-1lambda~6~,2-thiazole-1,1-dione
Chemical Structure Depiction of
3-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-5-[4-(propan-2-yl)phenyl]-1H-1lambda~6~,2-thiazole-1,1-dione
3-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-5-[4-(propan-2-yl)phenyl]-1H-1lambda~6~,2-thiazole-1,1-dione
Compound characteristics
| Compound ID: | E013-3118 |
| Compound Name: | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-methyl-5-[4-(propan-2-yl)phenyl]-1H-1lambda~6~,2-thiazole-1,1-dione |
| Molecular Weight: | 443.99 |
| Molecular Formula: | C23 H26 Cl N3 O2 S |
| Smiles: | CC(C)c1ccc(cc1)C1=C(C)C(=NS1(=O)=O)N1CCN(CC1)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.4981 |
| logD: | 5.4981 |
| logSw: | -6.1879 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.391 |
| InChI Key: | DFOLBXMYJDQUGP-UHFFFAOYSA-N |