N-{3-[benzyl(methyl)amino]propyl}-4,6-dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide
Chemical Structure Depiction of
N-{3-[benzyl(methyl)amino]propyl}-4,6-dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide
N-{3-[benzyl(methyl)amino]propyl}-4,6-dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | E014-0215 |
| Compound Name: | N-{3-[benzyl(methyl)amino]propyl}-4,6-dimethyl-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide |
| Molecular Weight: | 432.59 |
| Molecular Formula: | C25 H28 N4 O S |
| Smiles: | Cc1cc(C)nc2c1c(c(C(NCCCN(C)Cc1ccccc1)=O)s2)n1cccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5287 |
| logD: | 3.0876 |
| logSw: | -4.4462 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.498 |
| InChI Key: | CPAVBESIQMKHSR-UHFFFAOYSA-N |