4-(6-chloro-2-methyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-4-oxo-N-(2-phenylethyl)butanamide
Chemical Structure Depiction of
4-(6-chloro-2-methyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-4-oxo-N-(2-phenylethyl)butanamide
4-(6-chloro-2-methyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-4-oxo-N-(2-phenylethyl)butanamide
Compound characteristics
| Compound ID: | E015-0443 |
| Compound Name: | 4-(6-chloro-2-methyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-4-oxo-N-(2-phenylethyl)butanamide |
| Molecular Weight: | 386.88 |
| Molecular Formula: | C21 H23 Cl N2 O3 |
| Smiles: | CC1CN(C(CCC(NCCc2ccccc2)=O)=O)c2cc(ccc2O1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.85 |
| logD: | 2.85 |
| logSw: | -3.5162 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.385 |
| InChI Key: | LLWPNHKKPVNQRQ-OAHLLOKOSA-N |