4-(2,6-dimethyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-[(3-methoxyphenyl)methyl]-4-oxobutanamide
Chemical Structure Depiction of
4-(2,6-dimethyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-[(3-methoxyphenyl)methyl]-4-oxobutanamide
4-(2,6-dimethyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-[(3-methoxyphenyl)methyl]-4-oxobutanamide
Compound characteristics
| Compound ID: | E015-0759 |
| Compound Name: | 4-(2,6-dimethyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)-N-[(3-methoxyphenyl)methyl]-4-oxobutanamide |
| Molecular Weight: | 382.46 |
| Molecular Formula: | C22 H26 N2 O4 |
| Smiles: | CC1CN(C(CCC(NCc2cccc(c2)OC)=O)=O)c2cc(C)ccc2O1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0479 |
| logD: | 3.0479 |
| logSw: | -3.2852 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.088 |
| InChI Key: | YGRZBWXBCZYKFE-MRXNPFEDSA-N |