N-[2-(3,4-diethoxyphenyl)ethyl]-2-[4-oxo-2-(thiophen-2-yl)pyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]acetamide
Chemical Structure Depiction of
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[4-oxo-2-(thiophen-2-yl)pyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]acetamide
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[4-oxo-2-(thiophen-2-yl)pyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]acetamide
Compound characteristics
| Compound ID: | E016-0490 |
| Compound Name: | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[4-oxo-2-(thiophen-2-yl)pyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]acetamide |
| Molecular Weight: | 467.55 |
| Molecular Formula: | C23 H25 N5 O4 S |
| Smiles: | CCOc1ccc(CCNC(CN2C(c3cc(c4cccs4)nn3C=N2)=O)=O)cc1OCC |
| Stereo: | ACHIRAL |
| logP: | 1.5367 |
| logD: | 1.5367 |
| logSw: | -2.6215 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.897 |
| InChI Key: | LESYXZWMLOJBRQ-UHFFFAOYSA-N |