2-[2-(4-ethylphenyl)-7-methyl-4-oxopyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]-N-[(pyridin-3-yl)methyl]acetamide
Chemical Structure Depiction of
2-[2-(4-ethylphenyl)-7-methyl-4-oxopyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]-N-[(pyridin-3-yl)methyl]acetamide
2-[2-(4-ethylphenyl)-7-methyl-4-oxopyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]-N-[(pyridin-3-yl)methyl]acetamide
Compound characteristics
| Compound ID: | E016-2644 |
| Compound Name: | 2-[2-(4-ethylphenyl)-7-methyl-4-oxopyrazolo[1,5-d][1,2,4]triazin-5(4H)-yl]-N-[(pyridin-3-yl)methyl]acetamide |
| Molecular Weight: | 402.45 |
| Molecular Formula: | C22 H22 N6 O2 |
| Smiles: | CCc1ccc(cc1)c1cc2C(N(CC(NCc3cccnc3)=O)N=C(C)n2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5524 |
| logD: | 2.55 |
| logSw: | -2.3824 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.756 |
| InChI Key: | HDXFIBYDMUCKCW-UHFFFAOYSA-N |