N-[(2-chlorophenyl)methyl]-6-methoxy-3-(phenylsulfanyl)-1H-indole-2-carboxamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-6-methoxy-3-(phenylsulfanyl)-1H-indole-2-carboxamide
N-[(2-chlorophenyl)methyl]-6-methoxy-3-(phenylsulfanyl)-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | E018-1799 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-6-methoxy-3-(phenylsulfanyl)-1H-indole-2-carboxamide |
| Molecular Weight: | 422.93 |
| Molecular Formula: | C23 H19 Cl N2 O2 S |
| Smiles: | COc1ccc2c(c(C(NCc3ccccc3[Cl])=O)[nH]c2c1)Sc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.7071 |
| logD: | 5.7071 |
| logSw: | -6.0409 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.043 |
| InChI Key: | NCNUGNDKWCJKER-UHFFFAOYSA-N |